C27H42O4 — CID 42605702
1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-ethyldocosa-4,7,10,13,16,19-hexaenoate (PubChem CID 42605702) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-ethyldocosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-ethyldocosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 42605702 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-ethyldocosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CC(CC)C(=O)OC(CO)CO |
| InChI | InChI=1S/C27H42O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(4-2)27(30)31-26(23-28)24-29/h5-6,8-9,11-12,14-15,17-18,20-21,25-26,28-29H,3-4,7,10,13,16,19,22-24H2,1-2H3/b6-5+,9-8+,12-11+,15-14+,18-17+,21-20+ |
| InChIKey | RAEFVHCGBCOGMV-YATCGRJWSA-N |
| XLogP | 6.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|