About bis(2-ethylbutanoate);propanedial
bis(2-ethylbutanoate);propanedial (PubChem CID 21247443) has the molecular formula C15H26O6-2
and a molecular weight of 302.37 g/mol. Its IUPAC name is bis(2-ethylbutanoate);propanedial.
Molecular Properties
| Compound Name | bis(2-ethylbutanoate);propanedial |
| PubChem CID | 21247443 |
| Molecular Formula | C15H26O6-2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | bis(2-ethylbutanoate);propanedial |
| SMILES | CCC(CC)C(=O)[O-].CCC(CC)C(=O)[O-].O=CCC=O |
| InChI | InChI=1S/2C6H12O2.C3H4O2/c2*1-3-5(4-2)6(7)8;4-2-1-3-5/h2*5H,3-4H2,1-2H3,(H,7,8);2-3H,1H2/p-2 |
| InChIKey | IBFATBOFXUVHCT-UHFFFAOYSA-L |
| XLogP | 0.12 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethylbutanoate);propanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylbutanoate);propanedial?
The IUPAC name of bis(2-ethylbutanoate);propanedial (CID 21247443) is bis(2-ethylbutanoate);propanedial.
What is the SMILES notation for bis(2-ethylbutanoate);propanedial?
The canonical SMILES for bis(2-ethylbutanoate);propanedial is CCC(CC)C(=O)[O-].CCC(CC)C(=O)[O-].O=CCC=O.
What is the InChIKey of bis(2-ethylbutanoate);propanedial?
The InChIKey is IBFATBOFXUVHCT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H12O2.C3H4O2/c2*1-3-5(4-2)6(7)8;4-2-1-3-5/h2*5H,3-4H2,1-2H3,(H,7,8);2-3H,1H2/p-2.
What are the key properties of bis(2-ethylbutanoate);propanedial?
bis(2-ethylbutanoate);propanedial has a molecular weight of 302.37 g/mol, XLogP of 0.12, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylbutanoate);propanedial is sourced from PubChem (CID 21247443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).