About 4-ethylnon-6-en-2-one
4-ethylnon-6-en-2-one (PubChem CID 59068753) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-ethylnon-6-en-2-one.
Molecular Properties
| Compound Name | 4-ethylnon-6-en-2-one |
| PubChem CID | 59068753 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 4-ethylnon-6-en-2-one |
| SMILES | CCC=CCC(CC)CC(C)=O |
| InChI | InChI=1S/C11H20O/c1-4-6-7-8-11(5-2)9-10(3)12/h6-7,11H,4-5,8-9H2,1-3H3 |
| InChIKey | PRPWPTDMMRXWIR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylnon-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylnon-6-en-2-one?
The IUPAC name of 4-ethylnon-6-en-2-one (CID 59068753) is 4-ethylnon-6-en-2-one.
What is the SMILES notation for 4-ethylnon-6-en-2-one?
The canonical SMILES for 4-ethylnon-6-en-2-one is CCC=CCC(CC)CC(C)=O.
What is the InChIKey of 4-ethylnon-6-en-2-one?
The InChIKey is PRPWPTDMMRXWIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-4-6-7-8-11(5-2)9-10(3)12/h6-7,11H,4-5,8-9H2,1-3H3.
What are the key properties of 4-ethylnon-6-en-2-one?
4-ethylnon-6-en-2-one has a molecular weight of 168.28 g/mol, XLogP of 3.35, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylnon-6-en-2-one is sourced from PubChem (CID 59068753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).