C13H24 — CID 123598746
5-ethyl-2-methyldeca-1,7-diene (PubChem CID 123598746) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 5-ethyl-2-methyldeca-1,7-diene.
| Compound Name | 5-ethyl-2-methyldeca-1,7-diene |
|---|---|
| PubChem CID | 123598746 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 5-ethyl-2-methyldeca-1,7-diene |
| SMILES | C=C(C)CCC(CC)CC=CCC |
| InChI | InChI=1S/C13H24/c1-5-7-8-9-13(6-2)11-10-12(3)4/h7-8,13H,3,5-6,9-11H2,1-2,4H3 |
| InChIKey | PKHIUFPMSKGMEG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|