C67H114 — CID 162196667
2,10-dimethyl-5-(3-methylbut-3-enyl)-7-methylideneundeca-1,10-diene;20-ethyl-12-(8-ethyl-3,6-dimethylidenedecyl)-2-methyl-5-(3-methylbut-3-enyl)-7,10,15,18-tetramethylidenedocos-1-ene (PubChem CID 162196667) has the molecular formula C67H114 and a molecular weight of 919.65 g/mol. Its IUPAC name is 2,10-dimethyl-5-(3-methylbut-3-enyl)-7-methylideneundeca-1,10-diene;20-ethyl-12-(8-ethyl-3,6-dimethylidenedecyl)-2-methyl-5-(3-methylbut-3-enyl)-7,10,15,18-tetramethylidenedocos-1-ene.
| Compound Name | 2,10-dimethyl-5-(3-methylbut-3-enyl)-7-methylideneundeca-1,10-diene;20-ethyl-12-(8-ethyl-3,6-dimethylidenedecyl)-2-methyl-5-(3-methylbut-3-enyl)-7,10,15,18-tetramethylidenedocos-1-ene |
|---|---|
| PubChem CID | 162196667 |
| Molecular Formula | C67H114 |
| Molecular Weight | 919.65 g/mol |
| Exact Mass | 918.89 |
| IUPAC Name | 2,10-dimethyl-5-(3-methylbut-3-enyl)-7-methylideneundeca-1,10-diene;20-ethyl-12-(8-ethyl-3,6-dimethylidenedecyl)-2-methyl-5-(3-methylbut-3-enyl)-7,10,15,18-tetramethylidenedocos-1-ene |
| SMILES | C=C(C)CCC(=C)CC(CCC(=C)C)CCC(=C)C.C=C(C)CCC(CCC(=C)C)CC(=C)CCC(=C)CC(CCC(=C)CCC(=C)CC(CC)CC)CCC(=C)CCC(=C)CC(CC)CC |
| InChI | InChI=1S/C48H82.C19H32/c1-15-45(16-2)33-41(11)23-21-39(9)27-31-48(32-28-40(10)22-24-42(12)34-46(17-3)18-4)36-44(14)26-25-43(13)35-47(29-19-37(5)6)30-20-38(7)8;1-15(2)8-11-18(7)14-19(12-9-16(3)4)13-10-17(5)6/h45-48H,5,7,9-36H2,1-4,6,8H3;19H,1,3,5,7-14H2,2,4,6H3 |
| InChIKey | ZRALNAPIZPBPLC-UHFFFAOYSA-N |
| XLogP | 23.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 44 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.65 |
| LogP ≤ 5 | 23.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|