C14H24 — CID 143072031
(7Z,10E)-2,5-dimethyldodeca-1,7,10-triene (PubChem CID 143072031) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (7Z,10E)-2,5-dimethyldodeca-1,7,10-triene.
| Compound Name | (7Z,10E)-2,5-dimethyldodeca-1,7,10-triene |
|---|---|
| PubChem CID | 143072031 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (7Z,10E)-2,5-dimethyldodeca-1,7,10-triene |
| SMILES | C=C(C)CCC(C)C/C=C\C/C=C/C |
| InChI | InChI=1S/C14H24/c1-5-6-7-8-9-10-14(4)12-11-13(2)3/h5-6,8-9,14H,2,7,10-12H2,1,3-4H3/b6-5+,9-8- |
| InChIKey | FEXVQAGCRCDAPP-NKEWZBFXSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|