C10H21P — CID 123656905
4,7-dimethyloct-7-en-2-ylphosphane (PubChem CID 123656905) has the molecular formula C10H21P and a molecular weight of 172.25 g/mol. Its IUPAC name is 4,7-dimethyloct-7-en-2-ylphosphane.
| Compound Name | 4,7-dimethyloct-7-en-2-ylphosphane |
|---|---|
| PubChem CID | 123656905 |
| Molecular Formula | C10H21P |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 4,7-dimethyloct-7-en-2-ylphosphane |
| SMILES | C=C(C)CCC(C)CC(C)P |
| InChI | InChI=1S/C10H21P/c1-8(2)5-6-9(3)7-10(4)11/h9-10H,1,5-7,11H2,2-4H3 |
| InChIKey | WQFFIIXHRYSLDY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|