C21H37NO — CID 142943676
benzene;(3S,5R)-3-(dimethylamino)-5,8-dimethylnon-8-en-2-one;ethane (PubChem CID 142943676) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is benzene;(3S,5R)-3-(dimethylamino)-5,8-dimethylnon-8-en-2-one;ethane.
| Compound Name | benzene;(3S,5R)-3-(dimethylamino)-5,8-dimethylnon-8-en-2-one;ethane |
|---|---|
| PubChem CID | 142943676 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | benzene;(3S,5R)-3-(dimethylamino)-5,8-dimethylnon-8-en-2-one;ethane |
| SMILES | C=C(C)CC[C@@H](C)C[C@@H](C(C)=O)N(C)C.CC.c1ccccc1 |
| InChI | InChI=1S/C13H25NO.C6H6.C2H6/c1-10(2)7-8-11(3)9-13(12(4)15)14(5)6;1-2-4-6-5-3-1;1-2/h11,13H,1,7-9H2,2-6H3;1-6H;1-2H3/t11-,13+;;/m1../s1 |
| InChIKey | FIHPTUYPNYRZES-FZIZHOOBSA-N |
| XLogP | 5.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|