C19H31NO2 — CID 142943679
(3S,5R)-3-(dimethylamino)-8-hydroxy-5,8-dimethyl-9-phenylnonan-2-one (PubChem CID 142943679) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (3S,5R)-3-(dimethylamino)-8-hydroxy-5,8-dimethyl-9-phenylnonan-2-one.
| Compound Name | (3S,5R)-3-(dimethylamino)-8-hydroxy-5,8-dimethyl-9-phenylnonan-2-one |
|---|---|
| PubChem CID | 142943679 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (3S,5R)-3-(dimethylamino)-8-hydroxy-5,8-dimethyl-9-phenylnonan-2-one |
| SMILES | CC(=O)[C@H](C[C@H](C)CCC(C)(O)Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C19H31NO2/c1-15(13-18(16(2)21)20(4)5)11-12-19(3,22)14-17-9-7-6-8-10-17/h6-10,15,18,22H,11-14H2,1-5H3/t15-,18+,19?/m1/s1 |
| InChIKey | GYHCHTJTFYKSTL-XSFKQQOJSA-N |
| XLogP | 3.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |