C14H19ClO — CID 146469685
(2R)-2-benzyl-2,4-dimethylpentanoyl chloride (PubChem CID 146469685) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is (2R)-2-benzyl-2,4-dimethylpentanoyl chloride.
| Compound Name | (2R)-2-benzyl-2,4-dimethylpentanoyl chloride |
|---|---|
| PubChem CID | 146469685 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2R)-2-benzyl-2,4-dimethylpentanoyl chloride |
| SMILES | CC(C)C[C@](C)(Cc1ccccc1)C(=O)Cl |
| InChI | InChI=1S/C14H19ClO/c1-11(2)9-14(3,13(15)16)10-12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3/t14-/m1/s1 |
| InChIKey | XDTRIYXIHFPENB-CQSZACIVSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|