C12H12ClF3O — CID 146469643
2-benzyl-4,4,4-trifluoro-2-methylbutanoyl chloride (PubChem CID 146469643) has the molecular formula C12H12ClF3O and a molecular weight of 264.67 g/mol. Its IUPAC name is 2-benzyl-4,4,4-trifluoro-2-methylbutanoyl chloride.
| Compound Name | 2-benzyl-4,4,4-trifluoro-2-methylbutanoyl chloride |
|---|---|
| PubChem CID | 146469643 |
| Molecular Formula | C12H12ClF3O |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 2-benzyl-4,4,4-trifluoro-2-methylbutanoyl chloride |
| SMILES | CC(Cc1ccccc1)(CC(F)(F)F)C(=O)Cl |
| InChI | InChI=1S/C12H12ClF3O/c1-11(10(13)17,8-12(14,15)16)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | YBIBCTRFVAZYQG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|