C13H18F2 — CID 155030658
(4,4-difluoro-2,2-dimethylpentyl)benzene (PubChem CID 155030658) has the molecular formula C13H18F2 and a molecular weight of 212.28 g/mol. Its IUPAC name is (4,4-difluoro-2,2-dimethylpentyl)benzene.
| Compound Name | (4,4-difluoro-2,2-dimethylpentyl)benzene |
|---|---|
| PubChem CID | 155030658 |
| Molecular Formula | C13H18F2 |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (4,4-difluoro-2,2-dimethylpentyl)benzene |
| SMILES | CC(F)(F)CC(C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H18F2/c1-12(2,10-13(3,14)15)9-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | GGKCPTVHOSTELT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |