C14H17F3 — CID 166944677
[2,3-dimethyl-2-(2,2,2-trifluoroethyl)but-3-enyl]benzene (PubChem CID 166944677) has the molecular formula C14H17F3 and a molecular weight of 242.28 g/mol. Its IUPAC name is [2,3-dimethyl-2-(2,2,2-trifluoroethyl)but-3-enyl]benzene.
| Compound Name | [2,3-dimethyl-2-(2,2,2-trifluoroethyl)but-3-enyl]benzene |
|---|---|
| PubChem CID | 166944677 |
| Molecular Formula | C14H17F3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [2,3-dimethyl-2-(2,2,2-trifluoroethyl)but-3-enyl]benzene |
| SMILES | C=C(C)C(C)(Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C14H17F3/c1-11(2)13(3,10-14(15,16)17)9-12-7-5-4-6-8-12/h4-8H,1,9-10H2,2-3H3 |
| InChIKey | VBLSDECBKJQJCG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|