C11H12F3I — CID 139678016
(4,4,4-trifluoro-2-iodo-2-methylbutyl)benzene (PubChem CID 139678016) has the molecular formula C11H12F3I and a molecular weight of 328.11 g/mol. Its IUPAC name is (4,4,4-trifluoro-2-iodo-2-methylbutyl)benzene.
| Compound Name | (4,4,4-trifluoro-2-iodo-2-methylbutyl)benzene |
|---|---|
| PubChem CID | 139678016 |
| Molecular Formula | C11H12F3I |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | (4,4,4-trifluoro-2-iodo-2-methylbutyl)benzene |
| SMILES | CC(I)(Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C11H12F3I/c1-10(15,8-11(12,13)14)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | RSNYGZYEKQTSLR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|