C23H22F4N2O2 — CID 149444066
2-benzyl-4,4,4-trifluoro-N-(8-fluoroquinolin-3-yl)-N-(methoxymethyl)-2-methylbutanamide (PubChem CID 149444066) has the molecular formula C23H22F4N2O2 and a molecular weight of 434.43 g/mol. Its IUPAC name is 2-benzyl-4,4,4-trifluoro-N-(8-fluoroquinolin-3-yl)-N-(methoxymethyl)-2-methylbutanamide.
| Compound Name | 2-benzyl-4,4,4-trifluoro-N-(8-fluoroquinolin-3-yl)-N-(methoxymethyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 149444066 |
| Molecular Formula | C23H22F4N2O2 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-benzyl-4,4,4-trifluoro-N-(8-fluoroquinolin-3-yl)-N-(methoxymethyl)-2-methylbutanamide |
| SMILES | COCN(C(=O)C(C)(Cc1ccccc1)CC(F)(F)F)c1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C23H22F4N2O2/c1-22(14-23(25,26)27,12-16-7-4-3-5-8-16)21(30)29(15-31-2)18-11-17-9-6-10-19(24)20(17)28-13-18/h3-11,13H,12,14-15H2,1-2H3 |
| InChIKey | YWIHHPDBMILBBK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|