C20H16F4N2O — CID 175312240
8-fluoro-N-(4,4,4-trifluoro-2-phenylbutan-2-yl)quinoline-3-carboxamide (PubChem CID 175312240) has the molecular formula C20H16F4N2O and a molecular weight of 376.35 g/mol. Its IUPAC name is 8-fluoro-N-(4,4,4-trifluoro-2-phenylbutan-2-yl)quinoline-3-carboxamide.
| Compound Name | 8-fluoro-N-(4,4,4-trifluoro-2-phenylbutan-2-yl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 175312240 |
| Molecular Formula | C20H16F4N2O |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 8-fluoro-N-(4,4,4-trifluoro-2-phenylbutan-2-yl)quinoline-3-carboxamide |
| SMILES | CC(CC(F)(F)F)(NC(=O)c1cnc2c(F)cccc2c1)c1ccccc1 |
| InChI | InChI=1S/C20H16F4N2O/c1-19(12-20(22,23)24,15-7-3-2-4-8-15)26-18(27)14-10-13-6-5-9-16(21)17(13)25-11-14/h2-11H,12H2,1H3,(H,26,27) |
| InChIKey | QHAUXCGDXYMMKN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |