C23H23FN2O — CID 130405989
N-(2,4-dimethyl-1-phenylpent-4-en-2-yl)-8-fluoroquinoline-3-carboxamide (PubChem CID 130405989) has the molecular formula C23H23FN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(2,4-dimethyl-1-phenylpent-4-en-2-yl)-8-fluoroquinoline-3-carboxamide.
| Compound Name | N-(2,4-dimethyl-1-phenylpent-4-en-2-yl)-8-fluoroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 130405989 |
| Molecular Formula | C23H23FN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-(2,4-dimethyl-1-phenylpent-4-en-2-yl)-8-fluoroquinoline-3-carboxamide |
| SMILES | C=C(C)CC(C)(Cc1ccccc1)NC(=O)c1cnc2c(F)cccc2c1 |
| InChI | InChI=1S/C23H23FN2O/c1-16(2)13-23(3,14-17-8-5-4-6-9-17)26-22(27)19-12-18-10-7-11-20(24)21(18)25-15-19/h4-12,15H,1,13-14H2,2-3H3,(H,26,27) |
| InChIKey | SGSTZURMXPJQSD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|