C21H19F3N2O — CID 138473275
N-(4,4,4-trifluoro-2-methyl-1-phenylbutan-2-yl)quinoline-3-carboxamide (PubChem CID 138473275) has the molecular formula C21H19F3N2O and a molecular weight of 372.39 g/mol. Its IUPAC name is N-(4,4,4-trifluoro-2-methyl-1-phenylbutan-2-yl)quinoline-3-carboxamide.
| Compound Name | N-(4,4,4-trifluoro-2-methyl-1-phenylbutan-2-yl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 138473275 |
| Molecular Formula | C21H19F3N2O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-(4,4,4-trifluoro-2-methyl-1-phenylbutan-2-yl)quinoline-3-carboxamide |
| SMILES | CC(Cc1ccccc1)(CC(F)(F)F)NC(=O)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C21H19F3N2O/c1-20(14-21(22,23)24,12-15-7-3-2-4-8-15)26-19(27)17-11-16-9-5-6-10-18(16)25-13-17/h2-11,13H,12,14H2,1H3,(H,26,27) |
| InChIKey | LURGVLDDNWLNGG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |