C24H25FN2O — CID 148598876
(2R)-2-benzyl-N-(8-fluoro-4-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide (PubChem CID 148598876) has the molecular formula C24H25FN2O and a molecular weight of 376.48 g/mol. Its IUPAC name is (2R)-2-benzyl-N-(8-fluoro-4-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide.
| Compound Name | (2R)-2-benzyl-N-(8-fluoro-4-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 148598876 |
| Molecular Formula | C24H25FN2O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2R)-2-benzyl-N-(8-fluoro-4-methylquinolin-3-yl)-2,4-dimethylpent-4-enamide |
| SMILES | C=C(C)C[C@](C)(Cc1ccccc1)C(=O)Nc1cnc2c(F)cccc2c1C |
| InChI | InChI=1S/C24H25FN2O/c1-16(2)13-24(4,14-18-9-6-5-7-10-18)23(28)27-21-15-26-22-19(17(21)3)11-8-12-20(22)25/h5-12,15H,1,13-14H2,2-4H3,(H,27,28)/t24-/m1/s1 |
| InChIKey | NCCSTVLUUXTUJR-XMMPIXPASA-N |
| XLogP | 5.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|