C23H21FN2O — CID 146818531
2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2-methylpent-4-ynamide (PubChem CID 146818531) has the molecular formula C23H21FN2O and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2-methylpent-4-ynamide.
| Compound Name | 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2-methylpent-4-ynamide |
|---|---|
| PubChem CID | 146818531 |
| Molecular Formula | C23H21FN2O |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-benzyl-N-(8-fluoro-2-methylquinolin-3-yl)-2-methylpent-4-ynamide |
| SMILES | C#CCC(C)(Cc1ccccc1)C(=O)Nc1cc2cccc(F)c2nc1C |
| InChI | InChI=1S/C23H21FN2O/c1-4-13-23(3,15-17-9-6-5-7-10-17)22(27)26-20-14-18-11-8-12-19(24)21(18)25-16(20)2/h1,5-12,14H,13,15H2,2-3H3,(H,26,27) |
| InChIKey | SBOQVGHXEHNMKY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|