C24H23ClFNO — CID 160947935
3-benzyl-5-chloro-1-(8-fluoro-4-methylquinolin-3-yl)-3-methylhex-5-en-2-one (PubChem CID 160947935) has the molecular formula C24H23ClFNO and a molecular weight of 395.91 g/mol. Its IUPAC name is 3-benzyl-5-chloro-1-(8-fluoro-4-methylquinolin-3-yl)-3-methylhex-5-en-2-one.
| Compound Name | 3-benzyl-5-chloro-1-(8-fluoro-4-methylquinolin-3-yl)-3-methylhex-5-en-2-one |
|---|---|
| PubChem CID | 160947935 |
| Molecular Formula | C24H23ClFNO |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-benzyl-5-chloro-1-(8-fluoro-4-methylquinolin-3-yl)-3-methylhex-5-en-2-one |
| SMILES | C=C(Cl)CC(C)(Cc1ccccc1)C(=O)Cc1cnc2c(F)cccc2c1C |
| InChI | InChI=1S/C24H23ClFNO/c1-16(25)13-24(3,14-18-8-5-4-6-9-18)22(28)12-19-15-27-23-20(17(19)2)10-7-11-21(23)26/h4-11,15H,1,12-14H2,2-3H3 |
| InChIKey | SVJDKXFZUAJFAA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |