C16H13ClF2O — CID 117048265
2-(2,6-difluorophenyl)-2-methyl-3-phenylpropanoyl chloride (PubChem CID 117048265) has the molecular formula C16H13ClF2O and a molecular weight of 294.73 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-2-methyl-3-phenylpropanoyl chloride.
| Compound Name | 2-(2,6-difluorophenyl)-2-methyl-3-phenylpropanoyl chloride |
|---|---|
| PubChem CID | 117048265 |
| Molecular Formula | C16H13ClF2O |
| Molecular Weight | 294.73 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(2,6-difluorophenyl)-2-methyl-3-phenylpropanoyl chloride |
| SMILES | CC(Cc1ccccc1)(C(=O)Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C16H13ClF2O/c1-16(15(17)20,10-11-6-3-2-4-7-11)14-12(18)8-5-9-13(14)19/h2-9H,10H2,1H3 |
| InChIKey | BPLPHXQNOFADLD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|