C16H12ClF3O — CID 117048253
2-methyl-3-phenyl-2-(2,3,4-trifluorophenyl)propanoyl chloride (PubChem CID 117048253) has the molecular formula C16H12ClF3O and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-methyl-3-phenyl-2-(2,3,4-trifluorophenyl)propanoyl chloride.
| Compound Name | 2-methyl-3-phenyl-2-(2,3,4-trifluorophenyl)propanoyl chloride |
|---|---|
| PubChem CID | 117048253 |
| Molecular Formula | C16H12ClF3O |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-methyl-3-phenyl-2-(2,3,4-trifluorophenyl)propanoyl chloride |
| SMILES | CC(Cc1ccccc1)(C(=O)Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12ClF3O/c1-16(15(17)21,9-10-5-3-2-4-6-10)11-7-8-12(18)14(20)13(11)19/h2-8H,9H2,1H3 |
| InChIKey | BFZSHTRGSKYNDC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|