C17H10F9NO — CID 71672820
2-benzyl-3,3,3-trifluoro-2-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 71672820) has the molecular formula C17H10F9NO and a molecular weight of 415.26 g/mol. Its IUPAC name is 2-benzyl-3,3,3-trifluoro-2-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-benzyl-3,3,3-trifluoro-2-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 71672820 |
| Molecular Formula | C17H10F9NO |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-benzyl-3,3,3-trifluoro-2-(trifluoromethyl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C(Cc1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H10F9NO/c18-10-6-7-11(13(20)12(10)19)27-14(28)15(16(21,22)23,17(24,25)26)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,27,28) |
| InChIKey | MDLGUDVPPANNQY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|