C15H12Cl3NO — CID 117049122
2-(2,5-dichlorophenyl)-2-methyl-3-pyridin-4-ylpropanoyl chloride (PubChem CID 117049122) has the molecular formula C15H12Cl3NO and a molecular weight of 328.63 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-2-methyl-3-pyridin-4-ylpropanoyl chloride.
| Compound Name | 2-(2,5-dichlorophenyl)-2-methyl-3-pyridin-4-ylpropanoyl chloride |
|---|---|
| PubChem CID | 117049122 |
| Molecular Formula | C15H12Cl3NO |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-2-methyl-3-pyridin-4-ylpropanoyl chloride |
| SMILES | CC(Cc1ccncc1)(C(=O)Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl3NO/c1-15(14(18)20,9-10-4-6-19-7-5-10)12-8-11(16)2-3-13(12)17/h2-8H,9H2,1H3 |
| InChIKey | UGGQRBVUZPPJPA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|