C16H17Cl2N — CID 117048216
2-(2,5-dichlorophenyl)-2-methyl-3-phenylpropan-1-amine (PubChem CID 117048216) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-2-methyl-3-phenylpropan-1-amine.
| Compound Name | 2-(2,5-dichlorophenyl)-2-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 117048216 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-2-methyl-3-phenylpropan-1-amine |
| SMILES | CC(CN)(Cc1ccccc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H17Cl2N/c1-16(11-19,10-12-5-3-2-4-6-12)14-9-13(17)7-8-15(14)18/h2-9H,10-11,19H2,1H3 |
| InChIKey | MWEOCOYKEJXRCO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |