C17H18F2O2 — CID 114934981
2-benzyl-2-[(2,6-difluorophenyl)methyl]propane-1,3-diol (PubChem CID 114934981) has the molecular formula C17H18F2O2 and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-benzyl-2-[(2,6-difluorophenyl)methyl]propane-1,3-diol.
| Compound Name | 2-benzyl-2-[(2,6-difluorophenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 114934981 |
| Molecular Formula | C17H18F2O2 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-benzyl-2-[(2,6-difluorophenyl)methyl]propane-1,3-diol |
| SMILES | OCC(CO)(Cc1ccccc1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C17H18F2O2/c18-15-7-4-8-16(19)14(15)10-17(11-20,12-21)9-13-5-2-1-3-6-13/h1-8,20-21H,9-12H2 |
| InChIKey | LFWOTUYRCSJDKV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |