C13H18Cl2O3 — CID 174708997
2,2-dichloroacetic acid;2-methyl-1-phenylbutan-2-ol (PubChem CID 174708997) has the molecular formula C13H18Cl2O3 and a molecular weight of 293.19 g/mol. Its IUPAC name is 2,2-dichloroacetic acid;2-methyl-1-phenylbutan-2-ol.
| Compound Name | 2,2-dichloroacetic acid;2-methyl-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 174708997 |
| Molecular Formula | C13H18Cl2O3 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2,2-dichloroacetic acid;2-methyl-1-phenylbutan-2-ol |
| SMILES | CCC(C)(O)Cc1ccccc1.O=C(O)C(Cl)Cl |
| InChI | InChI=1S/C11H16O.C2H2Cl2O2/c1-3-11(2,12)9-10-7-5-4-6-8-10;3-1(4)2(5)6/h4-8,12H,3,9H2,1-2H3;1H,(H,5,6) |
| InChIKey | AERLXXRZDPJFCW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|