C21H40 — CID 123240548
2-methylprop-2-enylcyclohexane;2,5,7-trimethyloct-1-ene (PubChem CID 123240548) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 2-methylprop-2-enylcyclohexane;2,5,7-trimethyloct-1-ene.
| Compound Name | 2-methylprop-2-enylcyclohexane;2,5,7-trimethyloct-1-ene |
|---|---|
| PubChem CID | 123240548 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 2-methylprop-2-enylcyclohexane;2,5,7-trimethyloct-1-ene |
| SMILES | C=C(C)CC1CCCCC1.C=C(C)CCC(C)CC(C)C |
| InChI | InChI=1S/C11H22.C10H18/c1-9(2)6-7-11(5)8-10(3)4;1-9(2)8-10-6-4-3-5-7-10/h10-11H,1,6-8H2,2-5H3;10H,1,3-8H2,2H3 |
| InChIKey | GAQIVGTZOQHWQW-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|