C9H16O2 — CID 54560348
nona-2,4-diene-1,7-diol (PubChem CID 54560348) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is nona-2,4-diene-1,7-diol.
| Compound Name | nona-2,4-diene-1,7-diol |
|---|---|
| PubChem CID | 54560348 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | nona-2,4-diene-1,7-diol |
| SMILES | CCC(O)CC=CC=CCO |
| InChI | InChI=1S/C9H16O2/c1-2-9(11)7-5-3-4-6-8-10/h3-6,9-11H,2,7-8H2,1H3 |
| InChIKey | ZQCPQTQUZULHKV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|