C10H18O2 — CID 91327599
deca-4,6-diene-1,2-diol (PubChem CID 91327599) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is deca-4,6-diene-1,2-diol.
| Compound Name | deca-4,6-diene-1,2-diol |
|---|---|
| PubChem CID | 91327599 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | deca-4,6-diene-1,2-diol |
| SMILES | CCCC=CC=CCC(O)CO |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-10(12)9-11/h4-7,10-12H,2-3,8-9H2,1H3 |
| InChIKey | PEFOMWJFIPDOMC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|