C25H50O6 — CID 173320437
7-methyloct-2-ene-1,5-diol;oct-1-ene-1,6-diol;oct-2-ene-1,6-diol (PubChem CID 173320437) has the molecular formula C25H50O6 and a molecular weight of 446.67 g/mol. Its IUPAC name is 7-methyloct-2-ene-1,5-diol;oct-1-ene-1,6-diol;oct-2-ene-1,6-diol.
| Compound Name | 7-methyloct-2-ene-1,5-diol;oct-1-ene-1,6-diol;oct-2-ene-1,6-diol |
|---|---|
| PubChem CID | 173320437 |
| Molecular Formula | C25H50O6 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | 7-methyloct-2-ene-1,5-diol;oct-1-ene-1,6-diol;oct-2-ene-1,6-diol |
| SMILES | CC(C)CC(O)CC=CCO.CCC(O)CCC=CCO.CCC(O)CCCC=CO |
| InChI | InChI=1S/C9H18O2.2C8H16O2/c1-8(2)7-9(11)5-3-4-6-10;2*1-2-8(10)6-4-3-5-7-9/h3-4,8-11H,5-7H2,1-2H3;5,7-10H,2-4,6H2,1H3;3,5,8-10H,2,4,6-7H2,1H3 |
| InChIKey | SADHFJWJXNCILY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|