About 7,9-dimethyldecan-3-ol
7,9-dimethyldecan-3-ol (PubChem CID 156689495) has the molecular formula C12H26O
and a molecular weight of 186.34 g/mol. Its IUPAC name is 7,9-dimethyldecan-3-ol.
Molecular Properties
| Compound Name | 7,9-dimethyldecan-3-ol |
| PubChem CID | 156689495 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | 7,9-dimethyldecan-3-ol |
| SMILES | CCC(O)CCCC(C)CC(C)C |
| InChI | InChI=1S/C12H26O/c1-5-12(13)8-6-7-11(4)9-10(2)3/h10-13H,5-9H2,1-4H3 |
| InChIKey | XKKVBJUHRVNWEM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,9-dimethyldecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dimethyldecan-3-ol?
The IUPAC name of 7,9-dimethyldecan-3-ol (CID 156689495) is 7,9-dimethyldecan-3-ol.
What is the SMILES notation for 7,9-dimethyldecan-3-ol?
The canonical SMILES for 7,9-dimethyldecan-3-ol is CCC(O)CCCC(C)CC(C)C.
What is the InChIKey of 7,9-dimethyldecan-3-ol?
The InChIKey is XKKVBJUHRVNWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O/c1-5-12(13)8-6-7-11(4)9-10(2)3/h10-13H,5-9H2,1-4H3.
What are the key properties of 7,9-dimethyldecan-3-ol?
7,9-dimethyldecan-3-ol has a molecular weight of 186.34 g/mol, XLogP of 3.61, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dimethyldecan-3-ol is sourced from PubChem (CID 156689495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).