C12H20O2 — CID 59762600
(6Z)-2-ethyl-3-hydroxy-4-methylnona-6,8-dienal (PubChem CID 59762600) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (6Z)-2-ethyl-3-hydroxy-4-methylnona-6,8-dienal.
| Compound Name | (6Z)-2-ethyl-3-hydroxy-4-methylnona-6,8-dienal |
|---|---|
| PubChem CID | 59762600 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (6Z)-2-ethyl-3-hydroxy-4-methylnona-6,8-dienal |
| SMILES | C=C/C=C\CC(C)C(O)C(C=O)CC |
| InChI | InChI=1S/C12H20O2/c1-4-6-7-8-10(3)12(14)11(5-2)9-13/h4,6-7,9-12,14H,1,5,8H2,2-3H3/b7-6- |
| InChIKey | LERBGHYXGBQFKR-SREVYHEPSA-N |
| XLogP | 2.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|