C15H18 — CID 123397976
3-ethylidenehepta-4,6-dien-2-ylbenzene (PubChem CID 123397976) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-ethylidenehepta-4,6-dien-2-ylbenzene.
| Compound Name | 3-ethylidenehepta-4,6-dien-2-ylbenzene |
|---|---|
| PubChem CID | 123397976 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-ethylidenehepta-4,6-dien-2-ylbenzene |
| SMILES | C=CC=CC(=CC)C(C)c1ccccc1 |
| InChI | InChI=1S/C15H18/c1-4-6-10-14(5-2)13(3)15-11-8-7-9-12-15/h4-13H,1H2,2-3H3 |
| InChIKey | PPPIZDHLSXZCEK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|