C15H16O2 — CID 89222278
(3E,5Z)-4-[hydroxy(phenyl)methyl]octa-3,5,7-trienal (PubChem CID 89222278) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3E,5Z)-4-[hydroxy(phenyl)methyl]octa-3,5,7-trienal.
| Compound Name | (3E,5Z)-4-[hydroxy(phenyl)methyl]octa-3,5,7-trienal |
|---|---|
| PubChem CID | 89222278 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (3E,5Z)-4-[hydroxy(phenyl)methyl]octa-3,5,7-trienal |
| SMILES | C=C/C=C\C(=C/CC=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H16O2/c1-2-3-8-13(11-7-12-16)15(17)14-9-5-4-6-10-14/h2-6,8-12,15,17H,1,7H2/b8-3-,13-11+ |
| InChIKey | LBVCRBJEIHAFGN-FWOCSRCYSA-N |
| XLogP | 2.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|