(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid

C9H12O3 — CID 142066465

IUPAC(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid
SMILESC=C/C=C\C(=C/C)C(O)C(=O)O
InChIInChI=1S/C9H12O3/c1-3-5-6-7(4-2)8(10)9(11)12/h3-6,8,10H,1H2,2H3,(H,11,12)/b6-5-,7-4+
InChIKeyDMQQQPXQEGZRQG-IUQJDUBZSA-N
MW168.19 g/mol
LogP1.12
Rot. Bonds4

About (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid

(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid (PubChem CID 142066465) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid.

Molecular Properties

Compound Name(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid
PubChem CID142066465
Molecular FormulaC9H12O3
Molecular Weight168.19 g/mol
Exact Mass168.08
IUPAC Name(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid
SMILESC=C/C=C\C(=C/C)C(O)C(=O)O
InChIInChI=1S/C9H12O3/c1-3-5-6-7(4-2)8(10)9(11)12/h3-6,8,10H,1H2,2H3,(H,11,12)/b6-5-,7-4+
InChIKeyDMQQQPXQEGZRQG-IUQJDUBZSA-N
XLogP1.12
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.19
LogP ≤ 51.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid?
The IUPAC name of (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid (CID 142066465) is (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid.
What is the SMILES notation for (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid?
The canonical SMILES for (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid is C=C/C=C\C(=C/C)C(O)C(=O)O.
What is the InChIKey of (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid?
The InChIKey is DMQQQPXQEGZRQG-IUQJDUBZSA-N. The full InChI is InChI=1S/C9H12O3/c1-3-5-6-7(4-2)8(10)9(11)12/h3-6,8,10H,1H2,2H3,(H,11,12)/b6-5-,7-4+.
What are the key properties of (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid?
(3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid has a molecular weight of 168.19 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-3-ethylidene-2-hydroxyhepta-4,6-dienoic acid is sourced from PubChem (CID 142066465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).