C9H12O2 — CID 123881666
2-methyl-3-methylidenehepta-4,6-dienoic acid (PubChem CID 123881666) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-methyl-3-methylidenehepta-4,6-dienoic acid.
| Compound Name | 2-methyl-3-methylidenehepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 123881666 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-methyl-3-methylidenehepta-4,6-dienoic acid |
| SMILES | C=CC=CC(=C)C(C)C(=O)O |
| InChI | InChI=1S/C9H12O2/c1-4-5-6-7(2)8(3)9(10)11/h4-6,8H,1-2H2,3H3,(H,10,11) |
| InChIKey | JZUJFEBMUUJVGZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|