C9H14O — CID 143759474
(5Z)-4-methylideneocta-5,7-dien-3-ol (PubChem CID 143759474) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (5Z)-4-methylideneocta-5,7-dien-3-ol.
| Compound Name | (5Z)-4-methylideneocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 143759474 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (5Z)-4-methylideneocta-5,7-dien-3-ol |
| SMILES | C=C/C=C\C(=C)C(O)CC |
| InChI | InChI=1S/C9H14O/c1-4-6-7-8(3)9(10)5-2/h4,6-7,9-10H,1,3,5H2,2H3/b7-6- |
| InChIKey | NFSAPNHSAZIHNL-SREVYHEPSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|