C9H16O — CID 15579187
(5E)-4-methylocta-5,7-dien-3-ol (PubChem CID 15579187) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (5E)-4-methylocta-5,7-dien-3-ol.
| Compound Name | (5E)-4-methylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 15579187 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (5E)-4-methylocta-5,7-dien-3-ol |
| SMILES | C=C/C=C/C(C)C(O)CC |
| InChI | InChI=1S/C9H16O/c1-4-6-7-8(3)9(10)5-2/h4,6-10H,1,5H2,2-3H3/b7-6+ |
| InChIKey | XEFGFVHWGLKELH-VOTSOKGWSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|