C13H24O2 — CID 88931873
(3S,5R,6R,7E,9Z)-6-methyldodeca-7,9-diene-3,5-diol (PubChem CID 88931873) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (3S,5R,6R,7E,9Z)-6-methyldodeca-7,9-diene-3,5-diol.
| Compound Name | (3S,5R,6R,7E,9Z)-6-methyldodeca-7,9-diene-3,5-diol |
|---|---|
| PubChem CID | 88931873 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (3S,5R,6R,7E,9Z)-6-methyldodeca-7,9-diene-3,5-diol |
| SMILES | CC/C=C\C=C\[C@@H](C)[C@H](O)C[C@@H](O)CC |
| InChI | InChI=1S/C13H24O2/c1-4-6-7-8-9-11(3)13(15)10-12(14)5-2/h6-9,11-15H,4-5,10H2,1-3H3/b7-6-,9-8+/t11-,12+,13-/m1/s1 |
| InChIKey | SYSWDNQEKJTOKE-WXEYEEQRSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|