About (3R,5S)-5-sulfanylhexan-3-ol
(3R,5S)-5-sulfanylhexan-3-ol (PubChem CID 101345541) has the molecular formula C6H14OS
and a molecular weight of 134.24 g/mol. Its IUPAC name is (3R,5S)-5-sulfanylhexan-3-ol.
Molecular Properties
| Compound Name | (3R,5S)-5-sulfanylhexan-3-ol |
| PubChem CID | 101345541 |
| Molecular Formula | C6H14OS |
| Molecular Weight | 134.24 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (3R,5S)-5-sulfanylhexan-3-ol |
| SMILES | CC[C@@H](O)C[C@H](C)S |
| InChI | InChI=1S/C6H14OS/c1-3-6(7)4-5(2)8/h5-8H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | CLTCBQPTBSNRIK-NTSWFWBYSA-N |
| XLogP | 1.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-5-sulfanylhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-5-sulfanylhexan-3-ol?
The IUPAC name of (3R,5S)-5-sulfanylhexan-3-ol (CID 101345541) is (3R,5S)-5-sulfanylhexan-3-ol.
What is the SMILES notation for (3R,5S)-5-sulfanylhexan-3-ol?
The canonical SMILES for (3R,5S)-5-sulfanylhexan-3-ol is CC[C@@H](O)C[C@H](C)S.
What is the InChIKey of (3R,5S)-5-sulfanylhexan-3-ol?
The InChIKey is CLTCBQPTBSNRIK-NTSWFWBYSA-N. The full InChI is InChI=1S/C6H14OS/c1-3-6(7)4-5(2)8/h5-8H,3-4H2,1-2H3/t5-,6+/m0/s1.
What are the key properties of (3R,5S)-5-sulfanylhexan-3-ol?
(3R,5S)-5-sulfanylhexan-3-ol has a molecular weight of 134.24 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-5-sulfanylhexan-3-ol is sourced from PubChem (CID 101345541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).