About 5-(ethylamino)hexan-3-ol
5-(ethylamino)hexan-3-ol (PubChem CID 140740980) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is 5-(ethylamino)hexan-3-ol.
Molecular Properties
| Compound Name | 5-(ethylamino)hexan-3-ol |
| PubChem CID | 140740980 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 5-(ethylamino)hexan-3-ol |
| SMILES | CCNC(C)CC(O)CC |
| InChI | InChI=1S/C8H19NO/c1-4-8(10)6-7(3)9-5-2/h7-10H,4-6H2,1-3H3 |
| InChIKey | PZOCNMXKNJXRBP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(ethylamino)hexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylamino)hexan-3-ol?
The IUPAC name of 5-(ethylamino)hexan-3-ol (CID 140740980) is 5-(ethylamino)hexan-3-ol.
What is the SMILES notation for 5-(ethylamino)hexan-3-ol?
The canonical SMILES for 5-(ethylamino)hexan-3-ol is CCNC(C)CC(O)CC.
What is the InChIKey of 5-(ethylamino)hexan-3-ol?
The InChIKey is PZOCNMXKNJXRBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO/c1-4-8(10)6-7(3)9-5-2/h7-10H,4-6H2,1-3H3.
What are the key properties of 5-(ethylamino)hexan-3-ol?
5-(ethylamino)hexan-3-ol has a molecular weight of 145.25 g/mol, XLogP of 1.15, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylamino)hexan-3-ol is sourced from PubChem (CID 140740980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).