About carbanide;hexane-2,4-diol;yttrium
carbanide;hexane-2,4-diol;yttrium (PubChem CID 59749638) has the molecular formula C7H17O2Y-
and a molecular weight of 222.12 g/mol. Its IUPAC name is carbanide;hexane-2,4-diol;yttrium.
Molecular Properties
| Compound Name | carbanide;hexane-2,4-diol;yttrium |
| PubChem CID | 59749638 |
| Molecular Formula | C7H17O2Y- |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | carbanide;hexane-2,4-diol;yttrium |
| SMILES | CCC(O)CC(C)O.[CH3-].[Y] |
| InChI | InChI=1S/C6H14O2.CH3.Y/c1-3-6(8)4-5(2)7;;/h5-8H,3-4H2,1-2H3;1H3;/q;-1; |
| InChIKey | UHSDZFNNEKYQLF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;hexane-2,4-diol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;hexane-2,4-diol;yttrium?
The IUPAC name of carbanide;hexane-2,4-diol;yttrium (CID 59749638) is carbanide;hexane-2,4-diol;yttrium.
What is the SMILES notation for carbanide;hexane-2,4-diol;yttrium?
The canonical SMILES for carbanide;hexane-2,4-diol;yttrium is CCC(O)CC(C)O.[CH3-].[Y].
What is the InChIKey of carbanide;hexane-2,4-diol;yttrium?
The InChIKey is UHSDZFNNEKYQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.CH3.Y/c1-3-6(8)4-5(2)7;;/h5-8H,3-4H2,1-2H3;1H3;/q;-1;.
What are the key properties of carbanide;hexane-2,4-diol;yttrium?
carbanide;hexane-2,4-diol;yttrium has a molecular weight of 222.12 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;hexane-2,4-diol;yttrium is sourced from PubChem (CID 59749638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).