About (E,3R)-hept-4-en-3-ol
(E,3R)-hept-4-en-3-ol (PubChem CID 11007865) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is (E,3R)-hept-4-en-3-ol.
Molecular Properties
| Compound Name | (E,3R)-hept-4-en-3-ol |
| PubChem CID | 11007865 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | (E,3R)-hept-4-en-3-ol |
| SMILES | CC/C=C/[C@H](O)CC |
| InChI | InChI=1S/C7H14O/c1-3-5-6-7(8)4-2/h5-8H,3-4H2,1-2H3/b6-5+/t7-/m1/s1 |
| InChIKey | VOGZQUBNQCQGNN-WEWAHIQMSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,3R)-hept-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3R)-hept-4-en-3-ol?
The IUPAC name of (E,3R)-hept-4-en-3-ol (CID 11007865) is (E,3R)-hept-4-en-3-ol.
What is the SMILES notation for (E,3R)-hept-4-en-3-ol?
The canonical SMILES for (E,3R)-hept-4-en-3-ol is CC/C=C/[C@H](O)CC.
What is the InChIKey of (E,3R)-hept-4-en-3-ol?
The InChIKey is VOGZQUBNQCQGNN-WEWAHIQMSA-N. The full InChI is InChI=1S/C7H14O/c1-3-5-6-7(8)4-2/h5-8H,3-4H2,1-2H3/b6-5+/t7-/m1/s1.
What are the key properties of (E,3R)-hept-4-en-3-ol?
(E,3R)-hept-4-en-3-ol has a molecular weight of 114.19 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3R)-hept-4-en-3-ol is sourced from PubChem (CID 11007865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).