About (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol
(E)-2-methylhex-3-enoic acid;pent-1-en-3-ol (PubChem CID 88686843) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol.
Molecular Properties
| Compound Name | (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol |
| PubChem CID | 88686843 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol |
| SMILES | C=CC(O)CC.CC/C=C/C(C)C(=O)O |
| InChI | InChI=1S/C7H12O2.C5H10O/c1-3-4-5-6(2)7(8)9;1-3-5(6)4-2/h4-6H,3H2,1-2H3,(H,8,9);3,5-6H,1,4H2,2H3/b5-4+; |
| InChIKey | AGVFPWKQCSRHMQ-FXRZFVDSSA-N |
| XLogP | 2.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol?
The IUPAC name of (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol (CID 88686843) is (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol.
What is the SMILES notation for (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol?
The canonical SMILES for (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol is C=CC(O)CC.CC/C=C/C(C)C(=O)O.
What is the InChIKey of (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol?
The InChIKey is AGVFPWKQCSRHMQ-FXRZFVDSSA-N. The full InChI is InChI=1S/C7H12O2.C5H10O/c1-3-4-5-6(2)7(8)9;1-3-5(6)4-2/h4-6H,3H2,1-2H3,(H,8,9);3,5-6H,1,4H2,2H3/b5-4+;.
What are the key properties of (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol?
(E)-2-methylhex-3-enoic acid;pent-1-en-3-ol has a molecular weight of 214.30 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methylhex-3-enoic acid;pent-1-en-3-ol is sourced from PubChem (CID 88686843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).