C23H34O3 — CID 156679510
(5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2-methyldocosa-5,7,10,13,16,19-hexaenoic acid (PubChem CID 156679510) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2-methyldocosa-5,7,10,13,16,19-hexaenoic acid.
| Compound Name | (5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2-methyldocosa-5,7,10,13,16,19-hexaenoic acid |
|---|---|
| PubChem CID | 156679510 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2-methyldocosa-5,7,10,13,16,19-hexaenoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CC(C)C(=O)O |
| InChI | InChI=1S/C23H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)20-21(2)23(25)26/h4-5,7-8,10-11,13-14,16-19,21-22,24H,3,6,9,12,15,20H2,1-2H3,(H,25,26)/b5-4-,8-7-,11-10-,14-13-,17-16-,19-18+ |
| InChIKey | YMGRIUAPSJPLAK-MVWYYRFCSA-N |
| XLogP | 5.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|