C24H36O3 — CID 156679850
(5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2,2-dimethyldocosa-5,7,10,13,16,19-hexaenoic acid (PubChem CID 156679850) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2,2-dimethyldocosa-5,7,10,13,16,19-hexaenoic acid.
| Compound Name | (5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2,2-dimethyldocosa-5,7,10,13,16,19-hexaenoic acid |
|---|---|
| PubChem CID | 156679850 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (5E,7Z,10Z,13Z,16Z,19Z)-4-hydroxy-2,2-dimethyldocosa-5,7,10,13,16,19-hexaenoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C24H36O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(25)21-24(2,3)23(26)27/h5-6,8-9,11-12,14-15,17-20,22,25H,4,7,10,13,16,21H2,1-3H3,(H,26,27)/b6-5-,9-8-,12-11-,15-14-,18-17-,20-19+ |
| InChIKey | NHVHYAUJGUGOOP-RZAFJODCSA-N |
| XLogP | 6.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|