C25H38O3 — CID 156679770
(4Z,7Z,10Z,13Z,15E,19Z)-17-hydroxy-2,2,17-trimethyldocosa-4,7,10,13,15,19-hexaenoic acid (PubChem CID 156679770) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,15E,19Z)-17-hydroxy-2,2,17-trimethyldocosa-4,7,10,13,15,19-hexaenoic acid.
| Compound Name | (4Z,7Z,10Z,13Z,15E,19Z)-17-hydroxy-2,2,17-trimethyldocosa-4,7,10,13,15,19-hexaenoic acid |
|---|---|
| PubChem CID | 156679770 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (4Z,7Z,10Z,13Z,15E,19Z)-17-hydroxy-2,2,17-trimethyldocosa-4,7,10,13,15,19-hexaenoic acid |
| SMILES | CC/C=C\CC(C)(O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CC(C)(C)C(=O)O |
| InChI | InChI=1S/C25H38O3/c1-5-6-17-21-25(4,28)22-19-16-14-12-10-8-7-9-11-13-15-18-20-24(2,3)23(26)27/h6,8-11,14-19,22,28H,5,7,12-13,20-21H2,1-4H3,(H,26,27)/b10-8-,11-9-,16-14-,17-6-,18-15-,22-19+ |
| InChIKey | MHNKUQRPSZWXPI-JBTVTZNQSA-N |
| XLogP | 6.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|