C22H30O2 — CID 173077864
docosa-2,4,7,9,13,16,19-heptaenoic acid (PubChem CID 173077864) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is docosa-2,4,7,9,13,16,19-heptaenoic acid.
| Compound Name | docosa-2,4,7,9,13,16,19-heptaenoic acid |
|---|---|
| PubChem CID | 173077864 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | docosa-2,4,7,9,13,16,19-heptaenoic acid |
| SMILES | CCC=CCC=CCC=CCCC=CC=CCC=CC=CC(=O)O |
| InChI | InChI=1S/C22H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,13-16,18-21H,2,5,8,11-12,17H2,1H3,(H,23,24) |
| InChIKey | WNTISUQVDABGJP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|