docosa-2,4,7,9,13,16,19-heptaenoic acid

C22H30O2 — CID 173077864

IUPACdocosa-2,4,7,9,13,16,19-heptaenoic acid
SMILESCCC=CCC=CCC=CCCC=CC=CCC=CC=CC(=O)O
InChIInChI=1S/C22H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,13-16,18-21H,2,5,8,11-12,17H2,1H3,(H,23,24)
InChIKeyWNTISUQVDABGJP-UHFFFAOYSA-N
MW326.48 g/mol
LogP6.32
Rot. Bonds13

About docosa-2,4,7,9,13,16,19-heptaenoic acid

docosa-2,4,7,9,13,16,19-heptaenoic acid (PubChem CID 173077864) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is docosa-2,4,7,9,13,16,19-heptaenoic acid.

Molecular Properties

Compound Namedocosa-2,4,7,9,13,16,19-heptaenoic acid
PubChem CID173077864
Molecular FormulaC22H30O2
Molecular Weight326.48 g/mol
Exact Mass326.22
IUPAC Namedocosa-2,4,7,9,13,16,19-heptaenoic acid
SMILESCCC=CCC=CCC=CCCC=CC=CCC=CC=CC(=O)O
InChIInChI=1S/C22H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,13-16,18-21H,2,5,8,11-12,17H2,1H3,(H,23,24)
InChIKeyWNTISUQVDABGJP-UHFFFAOYSA-N
XLogP6.32
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500326.48
LogP ≤ 56.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze docosa-2,4,7,9,13,16,19-heptaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of docosa-2,4,7,9,13,16,19-heptaenoic acid?
The IUPAC name of docosa-2,4,7,9,13,16,19-heptaenoic acid (CID 173077864) is docosa-2,4,7,9,13,16,19-heptaenoic acid.
What is the SMILES notation for docosa-2,4,7,9,13,16,19-heptaenoic acid?
The canonical SMILES for docosa-2,4,7,9,13,16,19-heptaenoic acid is CCC=CCC=CCC=CCCC=CC=CCC=CC=CC(=O)O.
What is the InChIKey of docosa-2,4,7,9,13,16,19-heptaenoic acid?
The InChIKey is WNTISUQVDABGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,13-16,18-21H,2,5,8,11-12,17H2,1H3,(H,23,24).
What are the key properties of docosa-2,4,7,9,13,16,19-heptaenoic acid?
docosa-2,4,7,9,13,16,19-heptaenoic acid has a molecular weight of 326.48 g/mol, XLogP of 6.32, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docosa-2,4,7,9,13,16,19-heptaenoic acid is sourced from PubChem (CID 173077864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).